C42H54N4O4 — CID 6367639
N-[(E)-1-[4-[(E)-2-benzamido-3-(octylamino)-3-oxoprop-1-enyl]phenyl]-3-(octylamino)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 6367639) has the molecular formula C42H54N4O4 and a molecular weight of 678.92 g/mol. Its IUPAC name is N-[(E)-1-[4-[(E)-2-benzamido-3-(octylamino)-3-oxoprop-1-enyl]phenyl]-3-(octylamino)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-[4-[(E)-2-benzamido-3-(octylamino)-3-oxoprop-1-enyl]phenyl]-3-(octylamino)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 6367639 |
| Molecular Formula | C42H54N4O4 |
| Molecular Weight | 678.92 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | N-[(E)-1-[4-[(E)-2-benzamido-3-(octylamino)-3-oxoprop-1-enyl]phenyl]-3-(octylamino)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCCCCCNC(=O)/C(=C\c1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)NCCCCCCCC)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H54N4O4/c1-3-5-7-9-11-19-29-43-41(49)37(45-39(47)35-21-15-13-16-22-35)31-33-25-27-34(28-26-33)32-38(46-40(48)36-23-17-14-18-24-36)42(50)44-30-20-12-10-8-6-4-2/h13-18,21-28,31-32H,3-12,19-20,29-30H2,1-2H3,(H,43,49)(H,44,50)(H,45,47)(H,46,48)/b37-31+,38-32+ |
| InChIKey | SAHMPLMGBCUCJN-CBSZVXRSSA-N |
| XLogP | 8.18 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.92 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|