C22H24N2O4 — CID 3143045
6-[(2-benzamido-3-phenylprop-2-enoyl)amino]hexanoic acid (PubChem CID 3143045) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 6-[(2-benzamido-3-phenylprop-2-enoyl)amino]hexanoic acid.
| Compound Name | 6-[(2-benzamido-3-phenylprop-2-enoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 3143045 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 6-[(2-benzamido-3-phenylprop-2-enoyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(=Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4/c25-20(26)14-8-3-9-15-23-22(28)19(16-17-10-4-1-5-11-17)24-21(27)18-12-6-2-7-13-18/h1-2,4-7,10-13,16H,3,8-9,14-15H2,(H,23,28)(H,24,27)(H,25,26) |
| InChIKey | IPBZKTMLUNGVIT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|