C22H23BrN2O4 — CID 22301297
6-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 22301297) has the molecular formula C22H23BrN2O4 and a molecular weight of 459.34 g/mol. Its IUPAC name is 6-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22301297 |
| Molecular Formula | C22H23BrN2O4 |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 6-[[(Z)-2-benzamido-3-(4-bromophenyl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)/C(=C/c1ccc(Br)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23BrN2O4/c23-18-12-10-16(11-13-18)15-19(25-21(28)17-7-3-1-4-8-17)22(29)24-14-6-2-5-9-20(26)27/h1,3-4,7-8,10-13,15H,2,5-6,9,14H2,(H,24,29)(H,25,28)(H,26,27)/b19-15- |
| InChIKey | REZPOFWUTKTQHJ-CYVLTUHYSA-N |
| XLogP | 3.98 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|