C23H19BrN2O2 — CID 5438976
N-[(E)-3-(benzylamino)-1-(4-bromophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5438976) has the molecular formula C23H19BrN2O2 and a molecular weight of 435.32 g/mol. Its IUPAC name is N-[(E)-3-(benzylamino)-1-(4-bromophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-(benzylamino)-1-(4-bromophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5438976 |
| Molecular Formula | C23H19BrN2O2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-[(E)-3-(benzylamino)-1-(4-bromophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCc1ccccc1)/C(=C\c1ccc(Br)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19BrN2O2/c24-20-13-11-17(12-14-20)15-21(26-22(27)19-9-5-2-6-10-19)23(28)25-16-18-7-3-1-4-8-18/h1-15H,16H2,(H,25,28)(H,26,27)/b21-15+ |
| InChIKey | HSUCBHRRAMLMBH-RCCKNPSSSA-N |
| XLogP | 4.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|