C24H21BrN2O3 — CID 1316968
N-[(E)-3-(benzylamino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-bromobenzamide (PubChem CID 1316968) has the molecular formula C24H21BrN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is N-[(E)-3-(benzylamino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-bromobenzamide.
| Compound Name | N-[(E)-3-(benzylamino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-bromobenzamide |
|---|---|
| PubChem CID | 1316968 |
| Molecular Formula | C24H21BrN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | N-[(E)-3-(benzylamino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]-4-bromobenzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccc(Br)cc2)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21BrN2O3/c1-30-21-13-7-17(8-14-21)15-22(24(29)26-16-18-5-3-2-4-6-18)27-23(28)19-9-11-20(25)12-10-19/h2-15H,16H2,1H3,(H,26,29)(H,27,28)/b22-15+ |
| InChIKey | IICVXBHUYKCVAP-PXLXIMEGSA-N |
| XLogP | 4.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|