C19H16BrClN2O4 — CID 2254916
3-[[(Z)-2-[(4-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid (PubChem CID 2254916) has the molecular formula C19H16BrClN2O4 and a molecular weight of 451.70 g/mol. Its IUPAC name is 3-[[(Z)-2-[(4-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-2-[(4-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 2254916 |
| Molecular Formula | C19H16BrClN2O4 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | 3-[[(Z)-2-[(4-bromobenzoyl)amino]-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H16BrClN2O4/c20-14-5-3-13(4-6-14)18(26)23-16(19(27)22-10-9-17(24)25)11-12-1-7-15(21)8-2-12/h1-8,11H,9-10H2,(H,22,27)(H,23,26)(H,24,25)/b16-11- |
| InChIKey | YIJKQGXZKOKONA-WJDWOHSUSA-N |
| XLogP | 3.46 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|