C19H16ClN2O4- — CID 7290554
3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoate (PubChem CID 7290554) has the molecular formula C19H16ClN2O4- and a molecular weight of 371.80 g/mol. Its IUPAC name is 3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | 3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 7290554 |
| Molecular Formula | C19H16ClN2O4- |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-[[(Z)-2-benzamido-3-(4-chlorophenyl)prop-2-enoyl]amino]propanoate |
| SMILES | O=C([O-])CCNC(=O)/C(=C/c1ccc(Cl)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17ClN2O4/c20-15-8-6-13(7-9-15)12-16(19(26)21-11-10-17(23)24)22-18(25)14-4-2-1-3-5-14/h1-9,12H,10-11H2,(H,21,26)(H,22,25)(H,23,24)/p-1/b16-12- |
| InChIKey | XUJMPCQZKXWGEP-VBKFSLOCSA-M |
| XLogP | 1.37 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|