C18H18N2O5 — CID 2885296
4-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]butanoic acid (PubChem CID 2885296) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 2885296 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[[2-(furan-2-carbonylamino)-3-phenylprop-2-enoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)C(=Cc1ccccc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H18N2O5/c21-16(22)9-4-10-19-17(23)14(12-13-6-2-1-3-7-13)20-18(24)15-8-5-11-25-15/h1-3,5-8,11-12H,4,9-10H2,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | OZNRFGVHNOWTGD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|