C18H18N2O6 — CID 40509837
N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 40509837) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 40509837 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(NCCCO)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H18N2O6/c21-7-2-6-19-17(22)13(20-18(23)15-3-1-8-24-15)9-12-4-5-14-16(10-12)26-11-25-14/h1,3-5,8-10,21H,2,6-7,11H2,(H,19,22)(H,20,23)/b13-9- |
| InChIKey | ZOFIIWVRHMVSCT-LCYFTJDESA-N |
| XLogP | 1.28 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|