C19H16N2O6 — CID 2853606
2-[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid (PubChem CID 2853606) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 2853606 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[[2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O6/c22-17(23)10-20-19(25)14(21-18(24)13-4-2-1-3-5-13)8-12-6-7-15-16(9-12)27-11-26-15/h1-9H,10-11H2,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | LBARPNVLPKLFBS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|