C26H23N3O5 — CID 19057676
N-[(Z)-3-[(2-acetamidophenyl)methylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057676) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[(Z)-3-[(2-acetamidophenyl)methylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2-acetamidophenyl)methylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057676 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | N-[(Z)-3-[(2-acetamidophenyl)methylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccccc1CNC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O5/c1-17(30)28-21-10-6-5-9-20(21)15-27-26(32)22(29-25(31)19-7-3-2-4-8-19)13-18-11-12-23-24(14-18)34-16-33-23/h2-14H,15-16H2,1H3,(H,27,32)(H,28,30)(H,29,31)/b22-13- |
| InChIKey | BEYWUFJWZQHDNW-XKZIYDEJSA-N |
| XLogP | 3.46 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|