C27H26N2O5 — CID 2897598
N-[1-(1,3-benzodioxol-5-yl)-3-(benzylamino)-3-oxoprop-1-en-2-yl]-4-propoxybenzamide (PubChem CID 2897598) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-(benzylamino)-3-oxoprop-1-en-2-yl]-4-propoxybenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-(benzylamino)-3-oxoprop-1-en-2-yl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 2897598 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-(benzylamino)-3-oxoprop-1-en-2-yl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=Cc2ccc3c(c2)OCO3)C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-2-14-32-22-11-9-21(10-12-22)26(30)29-23(27(31)28-17-19-6-4-3-5-7-19)15-20-8-13-24-25(16-20)34-18-33-24/h3-13,15-16H,2,14,17-18H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | JRJHEBGJEKZVSF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|