C25H29NO6 — CID 6062932
2-methylpropyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[[4-(2-methylpropoxy)benzoyl]amino]prop-2-enoate (PubChem CID 6062932) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-methylpropyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[[4-(2-methylpropoxy)benzoyl]amino]prop-2-enoate.
| Compound Name | 2-methylpropyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[[4-(2-methylpropoxy)benzoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 6062932 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 2-methylpropyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[[4-(2-methylpropoxy)benzoyl]amino]prop-2-enoate |
| SMILES | CC(C)COC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C25H29NO6/c1-16(2)13-29-20-8-6-19(7-9-20)24(27)26-21(25(28)30-14-17(3)4)11-18-5-10-22-23(12-18)32-15-31-22/h5-12,16-17H,13-15H2,1-4H3,(H,26,27)/b21-11- |
| InChIKey | UDOIBHTYTIXKFA-NHDPSOOVSA-N |
| XLogP | 4.42 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|