C40H38N4O8 — CID 22304466
N-[(Z)-3-[6-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22304466) has the molecular formula C40H38N4O8 and a molecular weight of 702.76 g/mol. Its IUPAC name is N-[(Z)-3-[6-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[6-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22304466 |
| Molecular Formula | C40H38N4O8 |
| Molecular Weight | 702.76 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | N-[(Z)-3-[6-[[(E)-2-benzamido-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexylamino]-1-(1,3-benzodioxol-5-yl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(NCCCCCCNC(=O)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C40H38N4O8/c45-37(29-11-5-3-6-12-29)43-31(21-27-15-17-33-35(23-27)51-25-49-33)39(47)41-19-9-1-2-10-20-42-40(48)32(44-38(46)30-13-7-4-8-14-30)22-28-16-18-34-36(24-28)52-26-50-34/h3-8,11-18,21-24H,1-2,9-10,19-20,25-26H2,(H,41,47)(H,42,48)(H,43,45)(H,44,46)/b31-21-,32-22+ |
| InChIKey | GOXRUOUPSLQXMT-MXEGIGMXSA-N |
| XLogP | 5.18 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|