C21H21N2O7- — CID 7438797
6-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoate (PubChem CID 7438797) has the molecular formula C21H21N2O7- and a molecular weight of 413.41 g/mol. Its IUPAC name is 6-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoate.
| Compound Name | 6-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 7438797 |
| Molecular Formula | C21H21N2O7- |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 6-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoate |
| SMILES | O=C([O-])CCCCCNC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H22N2O7/c24-19(25)6-2-1-3-9-22-20(26)15(23-21(27)17-5-4-10-28-17)11-14-7-8-16-18(12-14)30-13-29-16/h4-5,7-8,10-12H,1-3,6,9,13H2,(H,22,26)(H,23,27)(H,24,25)/p-1/b15-11- |
| InChIKey | CLVOSQCVGXNPJB-PTNGSMBKSA-M |
| XLogP | 1.21 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|