C20H16ClN2O6- — CID 7258827
3-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-chlorobenzoyl)amino]prop-2-enoyl]amino]propanoate (PubChem CID 7258827) has the molecular formula C20H16ClN2O6- and a molecular weight of 415.81 g/mol. Its IUPAC name is 3-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-chlorobenzoyl)amino]prop-2-enoyl]amino]propanoate.
| Compound Name | 3-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-chlorobenzoyl)amino]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 7258827 |
| Molecular Formula | C20H16ClN2O6- |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 3-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-chlorobenzoyl)amino]prop-2-enoyl]amino]propanoate |
| SMILES | O=C([O-])CCNC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O6/c21-14-4-2-1-3-13(14)19(26)23-15(20(27)22-8-7-18(24)25)9-12-5-6-16-17(10-12)29-11-28-16/h1-6,9-10H,7-8,11H2,(H,22,27)(H,23,26)(H,24,25)/p-1/b15-9- |
| InChIKey | BJRAGOBDGIWCDB-DHDCSXOGSA-M |
| XLogP | 1.10 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|