C17H14ClN3O4 — CID 20831612
N-[(E)-1-(1,3-benzodioxol-5-yl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 20831612) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is N-[(E)-1-(1,3-benzodioxol-5-yl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 20831612 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | NNC(=O)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H14ClN3O4/c18-12-4-2-1-3-11(12)16(22)20-13(17(23)21-19)7-10-5-6-14-15(8-10)25-9-24-14/h1-8H,9,19H2,(H,20,22)(H,21,23)/b13-7+ |
| InChIKey | DMFBUCAYIKKGJT-NTUHNPAUSA-N |
| XLogP | 1.83 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|