C16H13BrClN3O2 — CID 3741390
N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide (PubChem CID 3741390) has the molecular formula C16H13BrClN3O2 and a molecular weight of 394.66 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide.
| Compound Name | N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3741390 |
| Molecular Formula | C16H13BrClN3O2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-2-chlorobenzamide |
| SMILES | NNC(=O)C(=Cc1ccc(Br)cc1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H13BrClN3O2/c17-11-7-5-10(6-8-11)9-14(16(23)21-19)20-15(22)12-3-1-2-4-13(12)18/h1-9H,19H2,(H,20,22)(H,21,23) |
| InChIKey | DNVJXYDRTKTVRC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|