C17H16BrN3O2 — CID 1366810
N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-3-methylbenzamide (PubChem CID 1366810) has the molecular formula C17H16BrN3O2 and a molecular weight of 374.24 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-3-methylbenzamide.
| Compound Name | N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 1366810 |
| Molecular Formula | C17H16BrN3O2 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N-[1-(4-bromophenyl)-3-hydrazinyl-3-oxoprop-1-en-2-yl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=Cc2ccc(Br)cc2)C(=O)NN)c1 |
| InChI | InChI=1S/C17H16BrN3O2/c1-11-3-2-4-13(9-11)16(22)20-15(17(23)21-19)10-12-5-7-14(18)8-6-12/h2-10H,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | RRXMFCSEFNZFSV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|