C24H21ClN2O4 — CID 2280061
2-chloro-N-[(Z)-3-(4-methoxyanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 2280061) has the molecular formula C24H21ClN2O4 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-3-(4-methoxyanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[(Z)-3-(4-methoxyanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 2280061 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-chloro-N-[(Z)-3-(4-methoxyanilino)-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2Cl)C(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN2O4/c1-30-18-11-7-16(8-12-18)15-22(27-23(28)20-5-3-4-6-21(20)25)24(29)26-17-9-13-19(31-2)14-10-17/h3-15H,1-2H3,(H,26,29)(H,27,28)/b22-15- |
| InChIKey | RCDICVABSPRYFB-JCMHNJIXSA-N |
| XLogP | 4.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|