C24H19ClN2O4 — CID 98446664
methyl 4-[[(Z)-2-[(2-chlorobenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate (PubChem CID 98446664) has the molecular formula C24H19ClN2O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-[(2-chlorobenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-[(2-chlorobenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 98446664 |
| Molecular Formula | C24H19ClN2O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | methyl 4-[[(Z)-2-[(2-chlorobenzoyl)amino]-3-phenylprop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O4/c1-31-24(30)17-11-13-18(14-12-17)26-23(29)21(15-16-7-3-2-4-8-16)27-22(28)19-9-5-6-10-20(19)25/h2-15H,1H3,(H,26,29)(H,27,28)/b21-15- |
| InChIKey | MPIVZUUFIHBZMK-QNGOZBTKSA-N |
| XLogP | 4.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|