C20H13Cl2N3O4S — CID 45068955
N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]-2,4-dichlorobenzamide (PubChem CID 45068955) has the molecular formula C20H13Cl2N3O4S and a molecular weight of 462.31 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 45068955 |
| Molecular Formula | C20H13Cl2N3O4S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-oxo-3-(1,3-thiazol-2-ylamino)prop-1-en-2-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1nccs1)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2N3O4S/c21-12-2-3-13(14(22)9-12)18(26)24-15(19(27)25-20-23-5-6-30-20)7-11-1-4-16-17(8-11)29-10-28-16/h1-9H,10H2,(H,24,26)(H,23,25,27)/b15-7- |
| InChIKey | GWJBFGVUSWLTKJ-CHHVJCJISA-N |
| XLogP | 4.59 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|