C24H18BrClN2O4 — CID 6617678
N-[1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methylanilino)-3-oxoprop-1-en-2-yl]-2-bromobenzamide (PubChem CID 6617678) has the molecular formula C24H18BrClN2O4 and a molecular weight of 513.78 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methylanilino)-3-oxoprop-1-en-2-yl]-2-bromobenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methylanilino)-3-oxoprop-1-en-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 6617678 |
| Molecular Formula | C24H18BrClN2O4 |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-methylanilino)-3-oxoprop-1-en-2-yl]-2-bromobenzamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H18BrClN2O4/c1-14-6-8-16(26)12-19(14)27-24(30)20(28-23(29)17-4-2-3-5-18(17)25)10-15-7-9-21-22(11-15)32-13-31-21/h2-12H,13H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | RVJMOXUFAQWTMT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|