C22H16BrNO6 — CID 1330505
furan-2-ylmethyl 3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate (PubChem CID 1330505) has the molecular formula C22H16BrNO6 and a molecular weight of 470.28 g/mol. Its IUPAC name is furan-2-ylmethyl 3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate.
| Compound Name | furan-2-ylmethyl 3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 1330505 |
| Molecular Formula | C22H16BrNO6 |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | furan-2-ylmethyl 3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate |
| SMILES | O=C(OCc1ccco1)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C22H16BrNO6/c23-17-6-2-1-5-16(17)21(25)24-18(22(26)28-12-15-4-3-9-27-15)10-14-7-8-19-20(11-14)30-13-29-19/h1-11H,12-13H2,(H,24,25) |
| InChIKey | ULGZUTIIRIMTCV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|