C17H12INO5 — CID 2187684
(E)-3-(1,3-benzodioxol-5-yl)-2-[(2-iodobenzoyl)amino]prop-2-enoic acid (PubChem CID 2187684) has the molecular formula C17H12INO5 and a molecular weight of 437.19 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-[(2-iodobenzoyl)amino]prop-2-enoic acid.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-[(2-iodobenzoyl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 2187684 |
| Molecular Formula | C17H12INO5 |
| Molecular Weight | 437.19 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-[(2-iodobenzoyl)amino]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C17H12INO5/c18-12-4-2-1-3-11(12)16(20)19-13(17(21)22)7-10-5-6-14-15(8-10)24-9-23-14/h1-8H,9H2,(H,19,20)(H,21,22)/b13-7+ |
| InChIKey | PHYZEGTWXQUZGP-NTUHNPAUSA-N |
| XLogP | 2.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|