C18H15NO5 — CID 5399941
(Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-methylbenzoyl)amino]prop-2-enoic acid (PubChem CID 5399941) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-methylbenzoyl)amino]prop-2-enoic acid.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-methylbenzoyl)amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 5399941 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-methylbenzoyl)amino]prop-2-enoic acid |
| SMILES | Cc1cccc(C(=O)N/C(=C\c2ccc3c(c2)OCO3)C(=O)O)c1 |
| InChI | InChI=1S/C18H15NO5/c1-11-3-2-4-13(7-11)17(20)19-14(18(21)22)8-12-5-6-15-16(9-12)24-10-23-15/h2-9H,10H2,1H3,(H,19,20)(H,21,22)/b14-8- |
| InChIKey | QZZZMGLZACQVGX-ZSOIEALJSA-N |
| XLogP | 2.58 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|