C18H14N2O7 — CID 40612940
methyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-nitrobenzoyl)amino]prop-2-enoate (PubChem CID 40612940) has the molecular formula C18H14N2O7 and a molecular weight of 370.32 g/mol. Its IUPAC name is methyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-nitrobenzoyl)amino]prop-2-enoate.
| Compound Name | methyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-nitrobenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 40612940 |
| Molecular Formula | C18H14N2O7 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | methyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(3-nitrobenzoyl)amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N2O7/c1-25-18(22)14(7-11-5-6-15-16(8-11)27-10-26-15)19-17(21)12-3-2-4-13(9-12)20(23)24/h2-9H,10H2,1H3,(H,19,21)/b14-7- |
| InChIKey | PLLIGGUDMUUCPX-AUWJEWJLSA-N |
| XLogP | 2.27 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|