C24H18BrNO5 — CID 2250431
benzyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate (PubChem CID 2250431) has the molecular formula C24H18BrNO5 and a molecular weight of 480.31 g/mol. Its IUPAC name is benzyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate.
| Compound Name | benzyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate |
|---|---|
| PubChem CID | 2250431 |
| Molecular Formula | C24H18BrNO5 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | benzyl (Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-bromobenzoyl)amino]prop-2-enoate |
| SMILES | O=C(OCc1ccccc1)/C(=C/c1ccc2c(c1)OCO2)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H18BrNO5/c25-19-9-5-4-8-18(19)23(27)26-20(24(28)29-14-16-6-2-1-3-7-16)12-17-10-11-21-22(13-17)31-15-30-21/h1-13H,14-15H2,(H,26,27)/b20-12- |
| InChIKey | WUPQQCANENGEKW-NDENLUEZSA-N |
| XLogP | 4.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|