C20H17N2O7- — CID 7365867
2-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]acetate (PubChem CID 7365867) has the molecular formula C20H17N2O7- and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]acetate.
| Compound Name | 2-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7365867 |
| Molecular Formula | C20H17N2O7- |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-[[(Z)-3-(1,3-benzodioxol-5-yl)-2-[(2-methoxybenzoyl)amino]prop-2-enoyl]amino]acetate |
| SMILES | COc1ccccc1C(=O)N/C(=C\c1ccc2c(c1)OCO2)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C20H18N2O7/c1-27-15-5-3-2-4-13(15)19(25)22-14(20(26)21-10-18(23)24)8-12-6-7-16-17(9-12)29-11-28-16/h2-9H,10-11H2,1H3,(H,21,26)(H,22,25)(H,23,24)/p-1/b14-8- |
| InChIKey | ZKXQPLKOPRPJKN-ZSOIEALJSA-M |
| XLogP | 0.06 |
| TPSA | 126.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|