C21H22N2O7 — CID 3137752
6-[[3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoic acid (PubChem CID 3137752) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is 6-[[3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 3137752 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 6-[[3-(1,3-benzodioxol-5-yl)-2-(furan-2-carbonylamino)prop-2-enoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)C(=Cc1ccc2c(c1)OCO2)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H22N2O7/c24-19(25)6-2-1-3-9-22-20(26)15(23-21(27)17-5-4-10-28-17)11-14-7-8-16-18(12-14)30-13-29-16/h4-5,7-8,10-12H,1-3,6,9,13H2,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | CLVOSQCVGXNPJB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|