C16H19NO5 — CID 23092236
6-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexanoic acid (PubChem CID 23092236) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 6-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexanoic acid.
| Compound Name | 6-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 23092236 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-[[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H19NO5/c18-15(17-9-3-1-2-4-16(19)20)8-6-12-5-7-13-14(10-12)22-11-21-13/h5-8,10H,1-4,9,11H2,(H,17,18)(H,19,20)/b8-6+ |
| InChIKey | IIXOIEKGMAHUBD-SOFGYWHQSA-N |
| XLogP | 2.19 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|