C13H12O5 — CID 5357561
(Z)-6-(1,3-benzodioxol-5-yl)-4-oxohex-5-enoic acid (PubChem CID 5357561) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (Z)-6-(1,3-benzodioxol-5-yl)-4-oxohex-5-enoic acid.
| Compound Name | (Z)-6-(1,3-benzodioxol-5-yl)-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 5357561 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (Z)-6-(1,3-benzodioxol-5-yl)-4-oxohex-5-enoic acid |
| SMILES | O=C(O)CCC(=O)/C=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H12O5/c14-10(4-6-13(15)16)3-1-9-2-5-11-12(7-9)18-8-17-11/h1-3,5,7H,4,6,8H2,(H,15,16)/b3-1- |
| InChIKey | SDPNHPWNIWGYTO-IWQZZHSRSA-N |
| XLogP | 1.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|