C14H14O3 — CID 134109702
(1E)-1-(1,3-benzodioxol-5-yl)hepta-1,6-dien-3-one (PubChem CID 134109702) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1E)-1-(1,3-benzodioxol-5-yl)hepta-1,6-dien-3-one.
| Compound Name | (1E)-1-(1,3-benzodioxol-5-yl)hepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 134109702 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (1E)-1-(1,3-benzodioxol-5-yl)hepta-1,6-dien-3-one |
| SMILES | C=CCCC(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H14O3/c1-2-3-4-12(15)7-5-11-6-8-13-14(9-11)17-10-16-13/h2,5-9H,1,3-4,10H2/b7-5+ |
| InChIKey | SJWDBDRHXQYZPA-FNORWQNLSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|