C20H26O4 — CID 10664180
(2E,12E)-13-(1,3-benzodioxol-5-yl)trideca-2,12-dienoic acid (PubChem CID 10664180) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2E,12E)-13-(1,3-benzodioxol-5-yl)trideca-2,12-dienoic acid.
| Compound Name | (2E,12E)-13-(1,3-benzodioxol-5-yl)trideca-2,12-dienoic acid |
|---|---|
| PubChem CID | 10664180 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2E,12E)-13-(1,3-benzodioxol-5-yl)trideca-2,12-dienoic acid |
| SMILES | O=C(O)/C=C/CCCCCCCC/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H26O4/c21-20(22)12-10-8-6-4-2-1-3-5-7-9-11-17-13-14-18-19(15-17)24-16-23-18/h9-15H,1-8,16H2,(H,21,22)/b11-9+,12-10+ |
| InChIKey | CNFPBEKNASQAAW-WGDLNXRISA-N |
| XLogP | 5.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|