C19H26O3 — CID 21157979
(E)-12-(1,3-benzodioxol-5-yl)dodec-3-en-2-one (PubChem CID 21157979) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (E)-12-(1,3-benzodioxol-5-yl)dodec-3-en-2-one.
| Compound Name | (E)-12-(1,3-benzodioxol-5-yl)dodec-3-en-2-one |
|---|---|
| PubChem CID | 21157979 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (E)-12-(1,3-benzodioxol-5-yl)dodec-3-en-2-one |
| SMILES | CC(=O)/C=C/CCCCCCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26O3/c1-16(20)10-8-6-4-2-3-5-7-9-11-17-12-13-18-19(14-17)22-15-21-18/h8,10,12-14H,2-7,9,11,15H2,1H3/b10-8+ |
| InChIKey | XDGBUGIPTBPSIQ-CSKARUKUSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|