C26H37NO3 — CID 163067839
(2E,4E,12E)-15-(1,3-benzodioxol-5-yl)-N-[(2S)-butan-2-yl]pentadeca-2,4,12-trienamide (PubChem CID 163067839) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is (2E,4E,12E)-15-(1,3-benzodioxol-5-yl)-N-[(2S)-butan-2-yl]pentadeca-2,4,12-trienamide.
| Compound Name | (2E,4E,12E)-15-(1,3-benzodioxol-5-yl)-N-[(2S)-butan-2-yl]pentadeca-2,4,12-trienamide |
|---|---|
| PubChem CID | 163067839 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | (2E,4E,12E)-15-(1,3-benzodioxol-5-yl)-N-[(2S)-butan-2-yl]pentadeca-2,4,12-trienamide |
| SMILES | CC[C@H](C)NC(=O)/C=C/C=C/CCCCCC/C=C/CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H37NO3/c1-3-22(2)27-26(28)17-15-13-11-9-7-5-4-6-8-10-12-14-16-23-18-19-24-25(20-23)30-21-29-24/h10-13,15,17-20,22H,3-9,14,16,21H2,1-2H3,(H,27,28)/b12-10+,13-11+,17-15+/t22-/m0/s1 |
| InChIKey | CILZQJJRCOHAIW-JVPFDUISSA-N |
| XLogP | 6.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|