C14H18O2 — CID 18786525
5-hept-6-enyl-1,3-benzodioxole (PubChem CID 18786525) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-hept-6-enyl-1,3-benzodioxole.
| Compound Name | 5-hept-6-enyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 18786525 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-hept-6-enyl-1,3-benzodioxole |
| SMILES | C=CCCCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O2/c1-2-3-4-5-6-7-12-8-9-13-14(10-12)16-11-15-13/h2,8-10H,1,3-7,11H2 |
| InChIKey | SJDILKRQZSMKNN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|