C12H12O4 — CID 6440042
[(E)-3-(1,3-benzodioxol-5-yl)prop-1-enyl] acetate (PubChem CID 6440042) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is [(E)-3-(1,3-benzodioxol-5-yl)prop-1-enyl] acetate.
| Compound Name | [(E)-3-(1,3-benzodioxol-5-yl)prop-1-enyl] acetate |
|---|---|
| PubChem CID | 6440042 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | [(E)-3-(1,3-benzodioxol-5-yl)prop-1-enyl] acetate |
| SMILES | CC(=O)O/C=C/Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12O4/c1-9(13)14-6-2-3-10-4-5-11-12(7-10)16-8-15-11/h2,4-7H,3,8H2,1H3/b6-2+ |
| InChIKey | AITBOCKNEMIZFG-QHHAFSJGSA-N |
| XLogP | 2.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|