C15H20O3 — CID 69187496
5-[(Z)-3-pentoxyprop-2-enyl]-1,3-benzodioxole (PubChem CID 69187496) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-[(Z)-3-pentoxyprop-2-enyl]-1,3-benzodioxole.
| Compound Name | 5-[(Z)-3-pentoxyprop-2-enyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 69187496 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-[(Z)-3-pentoxyprop-2-enyl]-1,3-benzodioxole |
| SMILES | CCCCCO/C=C\Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20O3/c1-2-3-4-9-16-10-5-6-13-7-8-14-15(11-13)18-12-17-14/h5,7-8,10-11H,2-4,6,9,12H2,1H3/b10-5- |
| InChIKey | LXILNPPJAUMTCJ-YHYXMXQVSA-N |
| XLogP | 3.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|