C13H14O5 — CID 77074985
4-(1,3-benzodioxol-5-ylmethoxy)-2-methylbut-2-enoic acid (PubChem CID 77074985) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethoxy)-2-methylbut-2-enoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethoxy)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 77074985 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethoxy)-2-methylbut-2-enoic acid |
| SMILES | CC(=CCOCc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C13H14O5/c1-9(13(14)15)4-5-16-7-10-2-3-11-12(6-10)18-8-17-11/h2-4,6H,5,7-8H2,1H3,(H,14,15) |
| InChIKey | VYFFNDPWXZRQNH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|