C15H18O5 — CID 77100582
methyl 4-(1,3-benzodioxol-5-ylmethoxy)-2-ethylbut-2-enoate (PubChem CID 77100582) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is methyl 4-(1,3-benzodioxol-5-ylmethoxy)-2-ethylbut-2-enoate.
| Compound Name | methyl 4-(1,3-benzodioxol-5-ylmethoxy)-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 77100582 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | methyl 4-(1,3-benzodioxol-5-ylmethoxy)-2-ethylbut-2-enoate |
| SMILES | CCC(=CCOCc1ccc2c(c1)OCO2)C(=O)OC |
| InChI | InChI=1S/C15H18O5/c1-3-12(15(16)17-2)6-7-18-9-11-4-5-13-14(8-11)20-10-19-13/h4-6,8H,3,7,9-10H2,1-2H3 |
| InChIKey | ATWAKDSUSGUHMQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|