C11H14O4 — CID 171395116
5-[2-(trideuteriomethoxy)ethoxymethyl]-1,3-benzodioxole (PubChem CID 171395116) has the molecular formula C11H14O4 and a molecular weight of 213.25 g/mol. Its IUPAC name is 5-[2-(trideuteriomethoxy)ethoxymethyl]-1,3-benzodioxole.
| Compound Name | 5-[2-(trideuteriomethoxy)ethoxymethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 171395116 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 5-[2-(trideuteriomethoxy)ethoxymethyl]-1,3-benzodioxole |
| SMILES | [2H]C([2H])([2H])OCCOCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14O4/c1-12-4-5-13-7-9-2-3-10-11(6-9)15-8-14-10/h2-3,6H,4-5,7-8H2,1H3/i1D3 |
| InChIKey | JYIZNARXTPKVTI-FIBGUPNXSA-N |
| XLogP | 1.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|