C14H16O4 — CID 151942297
ethyl 4-(1,3-benzodioxol-5-yl)-3-methylbut-2-enoate (PubChem CID 151942297) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxol-5-yl)-3-methylbut-2-enoate.
| Compound Name | ethyl 4-(1,3-benzodioxol-5-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 151942297 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | ethyl 4-(1,3-benzodioxol-5-yl)-3-methylbut-2-enoate |
| SMILES | CCOC(=O)C=C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H16O4/c1-3-16-14(15)7-10(2)6-11-4-5-12-13(8-11)18-9-17-12/h4-5,7-8H,3,6,9H2,1-2H3 |
| InChIKey | TUXWVJATXDPBCQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|