C19H19NO4 — CID 175924370
[4-(1,3-benzodioxol-5-yl)-2-deuterio-3-methylbut-2-enyl] 2-aminobenzoate (PubChem CID 175924370) has the molecular formula C19H19NO4 and a molecular weight of 326.37 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)-2-deuterio-3-methylbut-2-enyl] 2-aminobenzoate.
| Compound Name | [4-(1,3-benzodioxol-5-yl)-2-deuterio-3-methylbut-2-enyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 175924370 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)-2-deuterio-3-methylbut-2-enyl] 2-aminobenzoate |
| SMILES | [2H]C(COC(=O)c1ccccc1N)=C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19NO4/c1-13(10-14-6-7-17-18(11-14)24-12-23-17)8-9-22-19(21)15-4-2-3-5-16(15)20/h2-8,11H,9-10,12,20H2,1H3/i8D |
| InChIKey | XXRMCGVBIJZVKX-BNEYPBHNSA-N |
| XLogP | 3.34 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|