C15H19NO5 — CID 174453233
ethyl (2S)-2-acetamido-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate (PubChem CID 174453233) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl (2S)-2-acetamido-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate.
| Compound Name | ethyl (2S)-2-acetamido-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 174453233 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | ethyl (2S)-2-acetamido-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate |
| SMILES | CCOC(=O)[C@](C)(Cc1ccc2c(c1)OCO2)NC(C)=O |
| InChI | InChI=1S/C15H19NO5/c1-4-19-14(18)15(3,16-10(2)17)8-11-5-6-12-13(7-11)21-9-20-12/h5-7H,4,8-9H2,1-3H3,(H,16,17)/t15-/m0/s1 |
| InChIKey | IAQALTSONXRWRV-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |