C11H13NO4 — CID 6922991
(2R)-2-azaniumyl-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate (PubChem CID 6922991) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (2R)-2-azaniumyl-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate.
| Compound Name | (2R)-2-azaniumyl-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 6922991 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2R)-2-azaniumyl-3-(1,3-benzodioxol-5-yl)-2-methylpropanoate |
| SMILES | C[C@@]([NH3+])(Cc1ccc2c(c1)OCO2)C(=O)[O-] |
| InChI | InChI=1S/C11H13NO4/c1-11(12,10(13)14)5-7-2-3-8-9(4-7)16-6-15-8/h2-4H,5-6,12H2,1H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | KUHHQKOJDDCWIB-LLVKDONJSA-N |
| XLogP | -1.29 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |