C13H19NO2 — CID 82127786
1-(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-2-amine (PubChem CID 82127786) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-2-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 82127786 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-2-amine |
| SMILES | CC(C)C(C)(N)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO2/c1-9(2)13(3,14)7-10-4-5-11-12(6-10)16-8-15-11/h4-6,9H,7-8,14H2,1-3H3 |
| InChIKey | RKEXRSNUZRQHDH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |