C11H15NO2S — CID 66218496
1-(1,3-benzodioxol-5-ylmethylsulfanyl)propan-2-amine (PubChem CID 66218496) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethylsulfanyl)propan-2-amine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 66218496 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethylsulfanyl)propan-2-amine |
| SMILES | CC(N)CSCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO2S/c1-8(12)5-15-6-9-2-3-10-11(4-9)14-7-13-10/h2-4,8H,5-7,12H2,1H3 |
| InChIKey | TXPYEZJBBYWSTD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |