C11H13NO2 — CID 69401308
N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]methanimine (PubChem CID 69401308) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]methanimine.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]methanimine |
|---|---|
| PubChem CID | 69401308 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]methanimine |
| SMILES | C=NC(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8H,2,5,7H2,1H3 |
| InChIKey | UDYICYPRQAUKHI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|