C13H16O4 — CID 174832405
(4R)-3-(1,3-benzodioxol-5-ylmethyl)-4-hydroxypentanal (PubChem CID 174832405) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (4R)-3-(1,3-benzodioxol-5-ylmethyl)-4-hydroxypentanal.
| Compound Name | (4R)-3-(1,3-benzodioxol-5-ylmethyl)-4-hydroxypentanal |
|---|---|
| PubChem CID | 174832405 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4R)-3-(1,3-benzodioxol-5-ylmethyl)-4-hydroxypentanal |
| SMILES | C[C@@H](O)C(CC=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16O4/c1-9(15)11(4-5-14)6-10-2-3-12-13(7-10)17-8-16-12/h2-3,5,7,9,11,15H,4,6,8H2,1H3/t9-,11?/m1/s1 |
| InChIKey | ONNPGKBWRYIRLK-BFHBGLAWSA-N |
| XLogP | 1.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|